C23H28O6 — CID 5480987
5-hydroxy-6-(3-hydroxy-2,2-dimethylbutanoyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 5480987) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 5-hydroxy-6-(3-hydroxy-2,2-dimethylbutanoyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one.
| Compound Name | 5-hydroxy-6-(3-hydroxy-2,2-dimethylbutanoyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 5480987 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-hydroxy-6-(3-hydroxy-2,2-dimethylbutanoyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | CCCc1cc(=O)oc2c(C(=O)C(C)(C)C(C)O)c(O)c3c(c12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C23H28O6/c1-7-8-13-11-15(25)28-20-16(13)19-14(9-10-22(3,4)29-19)18(26)17(20)21(27)23(5,6)12(2)24/h9-12,24,26H,7-8H2,1-6H3 |
| InChIKey | CKYLXONSZBPDTG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|