About 3-ethyl-1,1,2,5-tetramethylsilole
3-ethyl-1,1,2,5-tetramethylsilole (PubChem CID 548103) has the molecular formula C10H18Si
and a molecular weight of 166.34 g/mol. Its IUPAC name is 3-ethyl-1,1,2,5-tetramethylsilole.
Molecular Properties
| Compound Name | 3-ethyl-1,1,2,5-tetramethylsilole |
| PubChem CID | 548103 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3-ethyl-1,1,2,5-tetramethylsilole |
| SMILES | CCC1=C(C)[Si](C)(C)C(C)=C1 |
| InChI | InChI=1S/C10H18Si/c1-6-10-7-8(2)11(4,5)9(10)3/h7H,6H2,1-5H3 |
| InChIKey | SFQGEJHHXRAZSO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,1,2,5-tetramethylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,1,2,5-tetramethylsilole?
The IUPAC name of 3-ethyl-1,1,2,5-tetramethylsilole (CID 548103) is 3-ethyl-1,1,2,5-tetramethylsilole.
What is the SMILES notation for 3-ethyl-1,1,2,5-tetramethylsilole?
The canonical SMILES for 3-ethyl-1,1,2,5-tetramethylsilole is CCC1=C(C)[Si](C)(C)C(C)=C1.
What is the InChIKey of 3-ethyl-1,1,2,5-tetramethylsilole?
The InChIKey is SFQGEJHHXRAZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Si/c1-6-10-7-8(2)11(4,5)9(10)3/h7H,6H2,1-5H3.
What are the key properties of 3-ethyl-1,1,2,5-tetramethylsilole?
3-ethyl-1,1,2,5-tetramethylsilole has a molecular weight of 166.34 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,1,2,5-tetramethylsilole is sourced from PubChem (CID 548103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).