C19H22ClN3O2 — CID 54810309
N-butyl-3-[[2-(4-chloroanilino)acetyl]amino]benzamide (PubChem CID 54810309) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is N-butyl-3-[[2-(4-chloroanilino)acetyl]amino]benzamide.
| Compound Name | N-butyl-3-[[2-(4-chloroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54810309 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-butyl-3-[[2-(4-chloroanilino)acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=O)CNc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-2-3-11-21-19(25)14-5-4-6-17(12-14)23-18(24)13-22-16-9-7-15(20)8-10-16/h4-10,12,22H,2-3,11,13H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | SRKHSOKUKMJPNL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|