C19H21Cl2N3O2 — CID 54810691
3-[3-[[2-(2,4-dichloroanilino)acetyl]amino]phenyl]-N,N-dimethylpropanamide (PubChem CID 54810691) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-[3-[[2-(2,4-dichloroanilino)acetyl]amino]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[3-[[2-(2,4-dichloroanilino)acetyl]amino]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54810691 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-[3-[[2-(2,4-dichloroanilino)acetyl]amino]phenyl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCc1cccc(NC(=O)CNc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-24(2)19(26)9-6-13-4-3-5-15(10-13)23-18(25)12-22-17-8-7-14(20)11-16(17)21/h3-5,7-8,10-11,22H,6,9,12H2,1-2H3,(H,23,25) |
| InChIKey | IYSDNPKNSXGUFB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |