About methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate
methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate (PubChem CID 548118) has the molecular formula C7H10O2S2
and a molecular weight of 190.29 g/mol. Its IUPAC name is methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate |
| PubChem CID | 548118 |
| Molecular Formula | C7H10O2S2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)SCCS1 |
| InChI | InChI=1S/C7H10O2S2/c1-5-6(7(8)9-2)11-4-3-10-5/h3-4H2,1-2H3 |
| InChIKey | XWJLLNTZGDCFCU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate?
The IUPAC name of methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate (CID 548118) is methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate.
What is the SMILES notation for methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate?
The canonical SMILES for methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate is COC(=O)C1=C(C)SCCS1.
What is the InChIKey of methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate?
The InChIKey is XWJLLNTZGDCFCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S2/c1-5-6(7(8)9-2)11-4-3-10-5/h3-4H2,1-2H3.
What are the key properties of methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate?
methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate has a molecular weight of 190.29 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-2,3-dihydro-1,4-dithiine-5-carboxylate is sourced from PubChem (CID 548118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).