C12H9N7O4 — CID 5481204
6-nitro-8-(2H-tetrazol-5-yl)-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione (PubChem CID 5481204) has the molecular formula C12H9N7O4 and a molecular weight of 315.25 g/mol. Its IUPAC name is 6-nitro-8-(2H-tetrazol-5-yl)-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione.
| Compound Name | 6-nitro-8-(2H-tetrazol-5-yl)-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 5481204 |
| Molecular Formula | C12H9N7O4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 6-nitro-8-(2H-tetrazol-5-yl)-4,7,8,9-tetrahydro-1H-cyclopenta[f]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c3c(c2[nH]c1=O)CC(c1nn[nH]n1)C3 |
| InChI | InChI=1S/C12H9N7O4/c20-11-12(21)14-9-6-2-4(10-15-17-18-16-10)1-5(6)8(19(22)23)3-7(9)13-11/h3-4H,1-2H2,(H,13,20)(H,14,21)(H,15,16,17,18) |
| InChIKey | RGJVHEFTAFJDPN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 163.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|