C44H30N4O4 — CID 5481276
4-[(10Z,14Z)-10,15-bis(4-hydroxyphenyl)-20-(4-oxocyclohexa-2,5-dien-1-ylidene)-21,22,23,24-tetrahydroporphyrin-5-ylidene]cyclohexa-2,5-dien-1-one (PubChem CID 5481276) has the molecular formula C44H30N4O4 and a molecular weight of 678.75 g/mol. Its IUPAC name is 4-[(10Z,14Z)-10,15-bis(4-hydroxyphenyl)-20-(4-oxocyclohexa-2,5-dien-1-ylidene)-21,22,23,24-tetrahydroporphyrin-5-ylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[(10Z,14Z)-10,15-bis(4-hydroxyphenyl)-20-(4-oxocyclohexa-2,5-dien-1-ylidene)-21,22,23,24-tetrahydroporphyrin-5-ylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 5481276 |
| Molecular Formula | C44H30N4O4 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 4-[(10Z,14Z)-10,15-bis(4-hydroxyphenyl)-20-(4-oxocyclohexa-2,5-dien-1-ylidene)-21,22,23,24-tetrahydroporphyrin-5-ylidene]cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=C2c3ccc([nH]3)C(=C3C=CC(=O)C=C3)c3ccc([nH]3)/C(c3ccc(O)cc3)=c3/cc/c([nH]3)=C(\c3ccc(O)cc3)c3ccc2[nH]3)C=C1 |
| InChI | InChI=1S/C44H30N4O4/c49-29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(50)12-4-26)37-21-23-39(47-37)44(28-7-15-32(52)16-8-28)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(51)14-6-27/h1-24,45-50H/b41-33-,42-35- |
| InChIKey | OXBXIINNAXASCM-BHHSRIIHSA-N |
| XLogP | 6.21 |
| TPSA | 137.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |