C22H26N2O4 — CID 54812800
propyl 4-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]benzoate (PubChem CID 54812800) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is propyl 4-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 54812800 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | propyl 4-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]benzoate |
| SMILES | C=C(C)COc1cccc(NC(=O)CNc2ccc(C(=O)OCCC)cc2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-4-12-27-22(26)17-8-10-18(11-9-17)23-14-21(25)24-19-6-5-7-20(13-19)28-15-16(2)3/h5-11,13,23H,2,4,12,14-15H2,1,3H3,(H,24,25) |
| InChIKey | ALFUNSDGZLHIGW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|