About porphyrin
porphyrin (PubChem CID 5481287) has the molecular formula C20H12N4
and a molecular weight of 308.34 g/mol. Its IUPAC name is porphyrin.
Molecular Properties
| Compound Name | porphyrin |
| PubChem CID | 5481287 |
| Molecular Formula | C20H12N4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | porphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3 |
| InChI | InChI=1S/C20H12N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | AJYZYPAMLMSWHG-CEVVSZFKSA-N |
| XLogP | 3.58 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of porphyrin?
The IUPAC name of porphyrin (CID 5481287) is porphyrin.
What is the SMILES notation for porphyrin?
The canonical SMILES for porphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.
What is the InChIKey of porphyrin?
The InChIKey is AJYZYPAMLMSWHG-CEVVSZFKSA-N. The full InChI is InChI=1S/C20H12N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-.
What are the key properties of porphyrin?
porphyrin has a molecular weight of 308.34 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for porphyrin is sourced from PubChem (CID 5481287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).