C22H28N2O4 — CID 54812902
propyl 4-[[2-(2-butoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 54812902) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is propyl 4-[[2-(2-butoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(2-butoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 54812902 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | propyl 4-[[2-(2-butoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOc1ccccc1NC(=O)CNc1ccc(C(=O)OCCC)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-3-5-15-27-20-9-7-6-8-19(20)24-21(25)16-23-18-12-10-17(11-13-18)22(26)28-14-4-2/h6-13,23H,3-5,14-16H2,1-2H3,(H,24,25) |
| InChIKey | LBUUKUHWKMQKMW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|