C21H23Cl2N3O2 — CID 54813365
2-(3,5-dichloroanilino)-N-[3-(4-methylpiperidine-1-carbonyl)phenyl]acetamide (PubChem CID 54813365) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-N-[3-(4-methylpiperidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(3,5-dichloroanilino)-N-[3-(4-methylpiperidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54813365 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(3,5-dichloroanilino)-N-[3-(4-methylpiperidine-1-carbonyl)phenyl]acetamide |
| SMILES | CC1CCN(C(=O)c2cccc(NC(=O)CNc3cc(Cl)cc(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-14-5-7-26(8-6-14)21(28)15-3-2-4-18(9-15)25-20(27)13-24-19-11-16(22)10-17(23)12-19/h2-4,9-12,14,24H,5-8,13H2,1H3,(H,25,27) |
| InChIKey | YVNKUZABWOOZPQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |