C23H32N2O2 — CID 54815004
N-(4-heptoxyphenyl)-2-(1-phenylethylamino)acetamide (PubChem CID 54815004) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-(4-heptoxyphenyl)-2-(1-phenylethylamino)acetamide.
| Compound Name | N-(4-heptoxyphenyl)-2-(1-phenylethylamino)acetamide |
|---|---|
| PubChem CID | 54815004 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N-(4-heptoxyphenyl)-2-(1-phenylethylamino)acetamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CNC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-3-4-5-6-10-17-27-22-15-13-21(14-16-22)25-23(26)18-24-19(2)20-11-8-7-9-12-20/h7-9,11-16,19,24H,3-6,10,17-18H2,1-2H3,(H,25,26) |
| InChIKey | YBUIDZBJKZMLJR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|