C25H31N3O2 — CID 54815622
N-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]acetyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54815622) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]acetyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]acetyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54815622 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[3-[[2-[2-(cyclohexen-1-yl)ethylamino]acetyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NC(=O)CNCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C25H31N3O2/c29-24(15-14-20-8-3-1-4-9-20)27-22-12-7-13-23(18-22)28-25(30)19-26-17-16-21-10-5-2-6-11-21/h1,3-4,7-10,12-13,18,26H,2,5-6,11,14-17,19H2,(H,27,29)(H,28,30) |
| InChIKey | XZJPOKJRZSTYOW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|