C20H24Cl2N2O2 — CID 54815954
2-(2,3-dichloroanilino)-N-(4-hexoxyphenyl)acetamide (PubChem CID 54815954) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-(2,3-dichloroanilino)-N-(4-hexoxyphenyl)acetamide.
| Compound Name | 2-(2,3-dichloroanilino)-N-(4-hexoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54815954 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-(2,3-dichloroanilino)-N-(4-hexoxyphenyl)acetamide |
| SMILES | CCCCCCOc1ccc(NC(=O)CNc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H24Cl2N2O2/c1-2-3-4-5-13-26-16-11-9-15(10-12-16)24-19(25)14-23-18-8-6-7-17(21)20(18)22/h6-12,23H,2-5,13-14H2,1H3,(H,24,25) |
| InChIKey | KCTHLHRAQVWGFA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|