C21H22Cl3N3O2 — CID 54816396
N-[4-(4-methylpiperidine-1-carbonyl)phenyl]-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816396) has the molecular formula C21H22Cl3N3O2 and a molecular weight of 454.79 g/mol. Its IUPAC name is N-[4-(4-methylpiperidine-1-carbonyl)phenyl]-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-[4-(4-methylpiperidine-1-carbonyl)phenyl]-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816396 |
| Molecular Formula | C21H22Cl3N3O2 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | N-[4-(4-methylpiperidine-1-carbonyl)phenyl]-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | CC1CCN(C(=O)c2ccc(NC(=O)CNc3cc(Cl)c(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22Cl3N3O2/c1-13-6-8-27(9-7-13)21(29)14-2-4-15(5-3-14)26-20(28)12-25-19-11-17(23)16(22)10-18(19)24/h2-5,10-11,13,25H,6-9,12H2,1H3,(H,26,28) |
| InChIKey | DTKRUEPYFAHCFZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|