About 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one
5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one (PubChem CID 5481691) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 5481691 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2c(N3CCOCC3)cc(N3CCOCC3)nc2[nH]1 |
| InChI | InChI=1S/C16H20N4O3/c21-15-2-1-12-13(19-3-7-22-8-4-19)11-14(17-16(12)18-15)20-5-9-23-10-6-20/h1-2,11H,3-10H2,(H,17,18,21) |
| InChIKey | SONQXUBFESJTBT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one (CID 5481691) is 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one is O=c1ccc2c(N3CCOCC3)cc(N3CCOCC3)nc2[nH]1.
What is the InChIKey of 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one?
The InChIKey is SONQXUBFESJTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O3/c21-15-2-1-12-13(19-3-7-22-8-4-19)11-14(17-16(12)18-15)20-5-9-23-10-6-20/h1-2,11H,3-10H2,(H,17,18,21).
What are the key properties of 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one?
5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one has a molecular weight of 316.36 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimorpholin-4-yl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 5481691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).