C20H24ClN3O2 — CID 54819366
N-butan-2-yl-3-[[2-(5-chloro-2-methylanilino)acetyl]amino]benzamide (PubChem CID 54819366) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-butan-2-yl-3-[[2-(5-chloro-2-methylanilino)acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-3-[[2-(5-chloro-2-methylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54819366 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-butan-2-yl-3-[[2-(5-chloro-2-methylanilino)acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(NC(=O)CNc2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-4-14(3)23-20(26)15-6-5-7-17(10-15)24-19(25)12-22-18-11-16(21)9-8-13(18)2/h5-11,14,22H,4,12H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | HTGFGYYRDPOJKP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |