C17H14N4O4 — CID 5482419
1-benzyl-4-[(Z)-1-hydroxy-3-oxo-3-(1H-1,2,4-triazol-5-yl)prop-1-enyl]pyrrole-2-carboxylic acid (PubChem CID 5482419) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-benzyl-4-[(Z)-1-hydroxy-3-oxo-3-(1H-1,2,4-triazol-5-yl)prop-1-enyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-benzyl-4-[(Z)-1-hydroxy-3-oxo-3-(1H-1,2,4-triazol-5-yl)prop-1-enyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 5482419 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-benzyl-4-[(Z)-1-hydroxy-3-oxo-3-(1H-1,2,4-triazol-5-yl)prop-1-enyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(/C=C(\O)c1cc(C(=O)O)n(Cc2ccccc2)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C17H14N4O4/c22-14(7-15(23)16-18-10-19-20-16)12-6-13(17(24)25)21(9-12)8-11-4-2-1-3-5-11/h1-7,9-10,22H,8H2,(H,24,25)(H,18,19,20)/b14-7- |
| InChIKey | IHAZMDDYPGQWDK-AUWJEWJLSA-N |
| XLogP | 2.13 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|