C12H12F7N3O3 — CID 548257
ethyl 4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl]imidazole-1-carboxylate (PubChem CID 548257) has the molecular formula C12H12F7N3O3 and a molecular weight of 379.23 g/mol. Its IUPAC name is ethyl 4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl]imidazole-1-carboxylate.
| Compound Name | ethyl 4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 548257 |
| Molecular Formula | C12H12F7N3O3 |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | ethyl 4-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl]imidazole-1-carboxylate |
| SMILES | CCOC(=O)n1cnc(CCNC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F7N3O3/c1-2-25-9(24)22-5-7(21-6-22)3-4-20-8(23)10(13,14)11(15,16)12(17,18)19/h5-6H,2-4H2,1H3,(H,20,23) |
| InChIKey | PYSMIFRRXNRZAQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|