C18H19ClN2O2 — CID 54825885
N-(2-chlorophenyl)-2-[2-(2-methylprop-2-enoxy)anilino]acetamide (PubChem CID 54825885) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-(2-methylprop-2-enoxy)anilino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-(2-methylprop-2-enoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54825885 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-(2-methylprop-2-enoxy)anilino]acetamide |
| SMILES | C=C(C)COc1ccccc1NCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O2/c1-13(2)12-23-17-10-6-5-9-16(17)20-11-18(22)21-15-8-4-3-7-14(15)19/h3-10,20H,1,11-12H2,2H3,(H,21,22) |
| InChIKey | YKWMKAVANJAZJC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|