C27H29N3O3 — CID 54826157
N-ethyl-4-[[2-[2-(2-methylprop-2-enoxy)anilino]acetyl]amino]-N-phenylbenzamide (PubChem CID 54826157) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-ethyl-4-[[2-[2-(2-methylprop-2-enoxy)anilino]acetyl]amino]-N-phenylbenzamide.
| Compound Name | N-ethyl-4-[[2-[2-(2-methylprop-2-enoxy)anilino]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 54826157 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-ethyl-4-[[2-[2-(2-methylprop-2-enoxy)anilino]acetyl]amino]-N-phenylbenzamide |
| SMILES | C=C(C)COc1ccccc1NCC(=O)Nc1ccc(C(=O)N(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-4-30(23-10-6-5-7-11-23)27(32)21-14-16-22(17-15-21)29-26(31)18-28-24-12-8-9-13-25(24)33-19-20(2)3/h5-17,28H,2,4,18-19H2,1,3H3,(H,29,31) |
| InChIKey | DSOTUYKKQDONIS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|