C24H24N2O3 — CID 54826275
N-(2-phenylmethoxyphenyl)-2-(3-prop-2-enoxyanilino)acetamide (PubChem CID 54826275) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(2-phenylmethoxyphenyl)-2-(3-prop-2-enoxyanilino)acetamide.
| Compound Name | N-(2-phenylmethoxyphenyl)-2-(3-prop-2-enoxyanilino)acetamide |
|---|---|
| PubChem CID | 54826275 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(2-phenylmethoxyphenyl)-2-(3-prop-2-enoxyanilino)acetamide |
| SMILES | C=CCOc1cccc(NCC(=O)Nc2ccccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-2-15-28-21-12-8-11-20(16-21)25-17-24(27)26-22-13-6-7-14-23(22)29-18-19-9-4-3-5-10-19/h2-14,16,25H,1,15,17-18H2,(H,26,27) |
| InChIKey | UZZGEZAMQJBIBS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|