C19H23ClN2O3 — CID 54827342
N-(3-chloro-2-methylphenyl)-2-[2-(2-ethoxyethoxy)anilino]acetamide (PubChem CID 54827342) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[2-(2-ethoxyethoxy)anilino]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[2-(2-ethoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54827342 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[2-(2-ethoxyethoxy)anilino]acetamide |
| SMILES | CCOCCOc1ccccc1NCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C19H23ClN2O3/c1-3-24-11-12-25-18-10-5-4-8-17(18)21-13-19(23)22-16-9-6-7-15(20)14(16)2/h4-10,21H,3,11-13H2,1-2H3,(H,22,23) |
| InChIKey | HLJJZKIEZKWQFK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|