C25H36N2O4 — CID 54827601
2-[2-(2-ethoxyethoxy)anilino]-N-(3-heptoxyphenyl)acetamide (PubChem CID 54827601) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)anilino]-N-(3-heptoxyphenyl)acetamide.
| Compound Name | 2-[2-(2-ethoxyethoxy)anilino]-N-(3-heptoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54827601 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)anilino]-N-(3-heptoxyphenyl)acetamide |
| SMILES | CCCCCCCOc1cccc(NC(=O)CNc2ccccc2OCCOCC)c1 |
| InChI | InChI=1S/C25H36N2O4/c1-3-5-6-7-10-16-30-22-13-11-12-21(19-22)27-25(28)20-26-23-14-8-9-15-24(23)31-18-17-29-4-2/h8-9,11-15,19,26H,3-7,10,16-18,20H2,1-2H3,(H,27,28) |
| InChIKey | RAXRQQMCPUEROH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|