C18H27N3O3 — CID 54828810
2-(3-methoxypropylamino)-N-[3-(piperidine-1-carbonyl)phenyl]acetamide (PubChem CID 54828810) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-N-[3-(piperidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(3-methoxypropylamino)-N-[3-(piperidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54828810 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-(3-methoxypropylamino)-N-[3-(piperidine-1-carbonyl)phenyl]acetamide |
| SMILES | COCCCNCC(=O)Nc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-24-12-6-9-19-14-17(22)20-16-8-5-7-15(13-16)18(23)21-10-3-2-4-11-21/h5,7-8,13,19H,2-4,6,9-12,14H2,1H3,(H,20,22) |
| InChIKey | IYSFXAILIXLZCW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|