C19H21ClN2O3 — CID 54829242
N-(4-chlorophenyl)-2-[3-(oxolan-2-ylmethoxy)anilino]acetamide (PubChem CID 54829242) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-(oxolan-2-ylmethoxy)anilino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-(oxolan-2-ylmethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54829242 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-(oxolan-2-ylmethoxy)anilino]acetamide |
| SMILES | O=C(CNc1cccc(OCC2CCCO2)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O3/c20-14-6-8-15(9-7-14)22-19(23)12-21-16-3-1-4-17(11-16)25-13-18-5-2-10-24-18/h1,3-4,6-9,11,18,21H,2,5,10,12-13H2,(H,22,23) |
| InChIKey | NLBQKTXJGZNNKM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |