C18H29N3O3 — CID 54829274
N-[3-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]hexanamide (PubChem CID 54829274) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[3-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54829274 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-[3-[[2-(3-methoxypropylamino)acetyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNCCCOC)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-3-4-5-10-17(22)20-15-8-6-9-16(13-15)21-18(23)14-19-11-7-12-24-2/h6,8-9,13,19H,3-5,7,10-12,14H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | QRKFNINEZHHHGO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|