C22H29N3O3 — CID 54830125
N-[3-[[2-(4-butan-2-yloxyanilino)acetyl]amino]phenyl]butanamide (PubChem CID 54830125) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[3-[[2-(4-butan-2-yloxyanilino)acetyl]amino]phenyl]butanamide.
| Compound Name | N-[3-[[2-(4-butan-2-yloxyanilino)acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54830125 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[3-[[2-(4-butan-2-yloxyanilino)acetyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)CNc2ccc(OC(C)CC)cc2)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-7-21(26)24-18-8-6-9-19(14-18)25-22(27)15-23-17-10-12-20(13-11-17)28-16(3)5-2/h6,8-14,16,23H,4-5,7,15H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | NCIXESWKNRMFOO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|