About 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione
1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione (PubChem CID 5483103) has the molecular formula C20H12N2O6
and a molecular weight of 376.32 g/mol. Its IUPAC name is 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione |
| PubChem CID | 5483103 |
| Molecular Formula | C20H12N2O6 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(O)ccc(Nc3ccccc3)c21 |
| InChI | InChI=1S/C20H12N2O6/c23-13-8-6-11(21-10-4-2-1-3-5-10)15-17(13)20(26)16-12(22(27)28)7-9-14(24)18(16)19(15)25/h1-9,21,23-24H |
| InChIKey | PHLHEYMNKXWDMC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione?
The IUPAC name of 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione (CID 5483103) is 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione.
What is the SMILES notation for 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione?
The canonical SMILES for 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione is O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(O)ccc(Nc3ccccc3)c21.
What is the InChIKey of 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione?
The InChIKey is PHLHEYMNKXWDMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2O6/c23-13-8-6-11(21-10-4-2-1-3-5-10)15-17(13)20(26)16-12(22(27)28)7-9-14(24)18(16)19(15)25/h1-9,21,23-24H.
What are the key properties of 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione?
1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione has a molecular weight of 376.32 g/mol, XLogP of 3.53, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-4,8-dihydroxy-5-nitroanthracene-9,10-dione is sourced from PubChem (CID 5483103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).