About CID 5483212
CID 5483212 (PubChem CID 5483212) has the molecular formula C2H3O3
and a molecular weight of 75.04 g/mol.
Molecular Properties
| Compound Name | CID 5483212 |
| PubChem CID | 5483212 |
| Molecular Formula | C2H3O3 |
| Molecular Weight | 75.04 g/mol |
| Exact Mass | 75.01 |
| IUPAC Name | — |
| SMILES | COC([O])=O |
| InChI | InChI=1S/C2H3O3/c1-5-2(3)4/h1H3 |
| InChIKey | JHZWMBRFGLKQSH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 46.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.04 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 5483212 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5483212?
The IUPAC name of CID 5483212 (CID 5483212) is not available.
What is the SMILES notation for CID 5483212?
The canonical SMILES for CID 5483212 is COC([O])=O.
What is the InChIKey of CID 5483212?
The InChIKey is JHZWMBRFGLKQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3O3/c1-5-2(3)4/h1H3.
What are the key properties of CID 5483212?
CID 5483212 has a molecular weight of 75.04 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5483212 is sourced from PubChem (CID 5483212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).