C20H24ClN3O2 — CID 54832867
4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 54832867) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 54832867 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CNCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-3-24(4-2)20(26)15-9-11-17(12-10-15)23-19(25)14-22-13-16-7-5-6-8-18(16)21/h5-12,22H,3-4,13-14H2,1-2H3,(H,23,25) |
| InChIKey | NMXHTBYZJJIDCB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |