C18H21N3O3 — CID 54833198
N-[3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]phenyl]propanamide (PubChem CID 54833198) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]phenyl]propanamide.
| Compound Name | N-[3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54833198 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[3-[[2-(4-methoxyanilino)-2-oxoethyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NCC(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-17(22)21-15-6-4-5-14(11-15)19-12-18(23)20-13-7-9-16(24-2)10-8-13/h4-11,19H,3,12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | GVMWCSWDLLNAJD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |