C20H22F3N3O2 — CID 54833776
N-tert-butyl-3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide (PubChem CID 54833776) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is N-tert-butyl-3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54833776 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-tert-butyl-3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=O)CNc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-19(2,3)26-18(28)13-6-4-9-16(10-13)25-17(27)12-24-15-8-5-7-14(11-15)20(21,22)23/h4-11,24H,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | UVFGAPULIUSLAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |