C22H24F3N3O2 — CID 54834910
2-[4-(azepane-1-carbonyl)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 54834910) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-[4-(azepane-1-carbonyl)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(azepane-1-carbonyl)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54834910 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-(azepane-1-carbonyl)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(C(=O)N2CCCCCC2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F3N3O2/c23-22(24,25)17-6-5-7-19(14-17)27-20(29)15-26-18-10-8-16(9-11-18)21(30)28-12-3-1-2-4-13-28/h5-11,14,26H,1-4,12-13,15H2,(H,27,29) |
| InChIKey | OYFACYSYXGVGCR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |