C23H31N3O3 — CID 54835273
N-butan-2-yl-3-[[2-[2-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54835273) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-butan-2-yl-3-[[2-[2-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-butan-2-yl-3-[[2-[2-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54835273 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-butan-2-yl-3-[[2-[2-(2-methylpropoxy)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(NCC(=O)Nc2ccccc2OCC(C)C)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-5-17(4)25-23(28)18-9-8-10-19(13-18)24-14-22(27)26-20-11-6-7-12-21(20)29-15-16(2)3/h6-13,16-17,24H,5,14-15H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | WFZVPTPHRSNSFL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |