C17H25N3O3 — CID 54836035
N-(2-methoxyethyl)-3-[(2-oxo-2-piperidin-1-ylethyl)amino]benzamide (PubChem CID 54836035) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(2-oxo-2-piperidin-1-ylethyl)amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-3-[(2-oxo-2-piperidin-1-ylethyl)amino]benzamide |
|---|---|
| PubChem CID | 54836035 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(2-oxo-2-piperidin-1-ylethyl)amino]benzamide |
| SMILES | COCCNC(=O)c1cccc(NCC(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-23-11-8-18-17(22)14-6-5-7-15(12-14)19-13-16(21)20-9-3-2-4-10-20/h5-7,12,19H,2-4,8-11,13H2,1H3,(H,18,22) |
| InChIKey | IEJNTYJDYUSQMW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|