C25H32N4O4 — CID 54836112
N-(2-methoxyethyl)-4-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54836112) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54836112 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[2-[4-(4-methylpiperidine-1-carbonyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(NCC(=O)Nc2ccc(C(=O)N3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O4/c1-18-11-14-29(15-12-18)25(32)20-5-9-22(10-6-20)28-23(30)17-27-21-7-3-19(4-8-21)24(31)26-13-16-33-2/h3-10,18,27H,11-17H2,1-2H3,(H,26,31)(H,28,30) |
| InChIKey | HASUHUNSOASDKZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|