C21H29N3O3 — CID 54836739
N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(morpholine-4-carbonyl)anilino]acetamide (PubChem CID 54836739) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(morpholine-4-carbonyl)anilino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(morpholine-4-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54836739 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[3-(morpholine-4-carbonyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(=O)N2CCOCC2)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H29N3O3/c25-20(22-10-9-17-5-2-1-3-6-17)16-23-19-8-4-7-18(15-19)21(26)24-11-13-27-14-12-24/h4-5,7-8,15,23H,1-3,6,9-14,16H2,(H,22,25) |
| InChIKey | QRAYZUPGAVPDDV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|