About cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate)
cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) (PubChem CID 5483694) has the molecular formula C30H22CoO4
and a molecular weight of 505.44 g/mol. Its IUPAC name is cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate).
Molecular Properties
| Compound Name | cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) |
| PubChem CID | 5483694 |
| Molecular Formula | C30H22CoO4 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) |
| SMILES | O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.[Co+2] |
| InChI | InChI=1S/2C15H12O2.Co/c2*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h2*1-11,16H;/q;;+2/p-2/b2*14-11-; |
| InChIKey | PHINRDPRLRZORI-AGIYBIRKSA-L |
| XLogP | 4.54 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate)?
The IUPAC name of cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) (CID 5483694) is cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate).
What is the SMILES notation for cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate)?
The canonical SMILES for cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) is O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.[Co+2].
What is the InChIKey of cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate)?
The InChIKey is PHINRDPRLRZORI-AGIYBIRKSA-L. The full InChI is InChI=1S/2C15H12O2.Co/c2*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h2*1-11,16H;/q;;+2/p-2/b2*14-11-;.
What are the key properties of cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate)?
cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) has a molecular weight of 505.44 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis((Z)-3-oxo-1,3-diphenylprop-1-en-1-olate) is sourced from PubChem (CID 5483694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).