C21H26N4O3 — CID 54837212
4-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 54837212) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54837212 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-[[2-[4-(butanoylamino)anilino]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(NCC(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-4-5-19(26)23-18-12-10-16(11-13-18)22-14-20(27)24-17-8-6-15(7-9-17)21(28)25(2)3/h6-13,22H,4-5,14H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | NMTFXKBVGHATQD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |