C19H19NO3 — CID 5483895
6-hydroxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one (PubChem CID 5483895) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is 6-hydroxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one.
| Compound Name | 6-hydroxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 5483895 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 6-hydroxy-3,3,12-trimethyl-1,2-dihydropyrano[2,3-c]acridin-7-one |
| SMILES | Cn1c2ccccc2c(=O)c2c(O)cc3c(c21)CCC(C)(C)O3 |
| InChI | InChI=1S/C19H19NO3/c1-19(2)9-8-12-15(23-19)10-14(21)16-17(12)20(3)13-7-5-4-6-11(13)18(16)22/h4-7,10,21H,8-9H2,1-3H3 |
| InChIKey | WSQFRVYIGHDUQT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|