C25H26N4O3 — CID 54839157
N-[3-[[2-[3-(butanoylamino)anilino]-2-oxoethyl]amino]phenyl]benzamide (PubChem CID 54839157) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[3-[[2-[3-(butanoylamino)anilino]-2-oxoethyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-[3-(butanoylamino)anilino]-2-oxoethyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54839157 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[3-[[2-[3-(butanoylamino)anilino]-2-oxoethyl]amino]phenyl]benzamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)CNc2cccc(NC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-2-8-23(30)27-20-12-7-13-21(16-20)28-24(31)17-26-19-11-6-14-22(15-19)29-25(32)18-9-4-3-5-10-18/h3-7,9-16,26H,2,8,17H2,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | MTKDUBDDNTWSEZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |