C29H34N4O3 — CID 54841033
N-benzyl-3-[[2-[3-(hexanoylamino)anilino]acetyl]amino]-N-methylbenzamide (PubChem CID 54841033) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-benzyl-3-[[2-[3-(hexanoylamino)anilino]acetyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[[2-[3-(hexanoylamino)anilino]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54841033 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-benzyl-3-[[2-[3-(hexanoylamino)anilino]acetyl]amino]-N-methylbenzamide |
| SMILES | CCCCCC(=O)Nc1cccc(NCC(=O)Nc2cccc(C(=O)N(C)Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H34N4O3/c1-3-4-6-17-27(34)31-26-16-10-14-24(19-26)30-20-28(35)32-25-15-9-13-23(18-25)29(36)33(2)21-22-11-7-5-8-12-22/h5,7-16,18-19,30H,3-4,6,17,20-21H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | ZPNBUQBWHSWQRV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|