C25H33N3O3 — CID 54841190
3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N,N-dipropylbenzamide (PubChem CID 54841190) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N,N-dipropylbenzamide.
| Compound Name | 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 54841190 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[[2-[3-(2-methylprop-2-enoxy)anilino]-2-oxoethyl]amino]-N,N-dipropylbenzamide |
| SMILES | C=C(C)COc1cccc(NC(=O)CNc2cccc(C(=O)N(CCC)CCC)c2)c1 |
| InChI | InChI=1S/C25H33N3O3/c1-5-13-28(14-6-2)25(30)20-9-7-10-21(15-20)26-17-24(29)27-22-11-8-12-23(16-22)31-18-19(3)4/h7-12,15-16,26H,3,5-6,13-14,17-18H2,1-2,4H3,(H,27,29) |
| InChIKey | WDHGXMNESIQPGV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|