C22H27N3O2 — CID 54841651
N-(2,3-dimethylphenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide (PubChem CID 54841651) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54841651 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(piperidine-1-carbonyl)anilino]acetamide |
| SMILES | Cc1cccc(NC(=O)CNc2ccc(C(=O)N3CCCCC3)cc2)c1C |
| InChI | InChI=1S/C22H27N3O2/c1-16-7-6-8-20(17(16)2)24-21(26)15-23-19-11-9-18(10-12-19)22(27)25-13-4-3-5-14-25/h6-12,23H,3-5,13-15H2,1-2H3,(H,24,26) |
| InChIKey | MMWPDBPHPMXMIF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |