C31H31N3O3 — CID 54841930
N-benzyl-N-methyl-3-[[2-oxo-2-[3-(2-phenylethoxy)anilino]ethyl]amino]benzamide (PubChem CID 54841930) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[2-oxo-2-[3-(2-phenylethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | N-benzyl-N-methyl-3-[[2-oxo-2-[3-(2-phenylethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54841930 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N-benzyl-N-methyl-3-[[2-oxo-2-[3-(2-phenylethoxy)anilino]ethyl]amino]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccc(NCC(=O)Nc2cccc(OCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H31N3O3/c1-34(23-25-12-6-3-7-13-25)31(36)26-14-8-15-27(20-26)32-22-30(35)33-28-16-9-17-29(21-28)37-19-18-24-10-4-2-5-11-24/h2-17,20-21,32H,18-19,22-23H2,1H3,(H,33,35) |
| InChIKey | RXHQOQUDDDIGDO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |