C29H32N4O3 — CID 54843132
3-methyl-N-[4-[[2-[3-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]phenyl]benzamide (PubChem CID 54843132) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-[3-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-[3-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54843132 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 3-methyl-N-[4-[[2-[3-(4-methylpiperidine-1-carbonyl)anilino]acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)CNc3cccc(C(=O)N4CCC(C)CC4)c3)cc2)c1 |
| InChI | InChI=1S/C29H32N4O3/c1-20-13-15-33(16-14-20)29(36)23-7-4-8-26(18-23)30-19-27(34)31-24-9-11-25(12-10-24)32-28(35)22-6-3-5-21(2)17-22/h3-12,17-18,20,30H,13-16,19H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | YCPCVXXNINKCEJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |