C19H23N3O3 — CID 54844190
N-benzyl-4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]benzamide (PubChem CID 54844190) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-benzyl-4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-benzyl-4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54844190 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-benzyl-4-[[2-(2-methoxyethylamino)-2-oxoethyl]amino]benzamide |
| SMILES | COCCNC(=O)CNc1ccc(C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-25-12-11-20-18(23)14-21-17-9-7-16(8-10-17)19(24)22-13-15-5-3-2-4-6-15/h2-10,21H,11-14H2,1H3,(H,20,23)(H,22,24) |
| InChIKey | ONZLHSAGMBDMJG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|