C22H26ClN3O2 — CID 54844214
4-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]-N-cyclohexylbenzamide (PubChem CID 54844214) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 4-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 4-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54844214 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]-N-cyclohexylbenzamide |
| SMILES | O=C(CNc1ccc(C(=O)NC2CCCCC2)cc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H26ClN3O2/c23-20-9-5-4-6-17(20)14-25-21(27)15-24-18-12-10-16(11-13-18)22(28)26-19-7-2-1-3-8-19/h4-6,9-13,19,24H,1-3,7-8,14-15H2,(H,25,27)(H,26,28) |
| InChIKey | WWSSOBUGELFSPO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |