C27H30N4O3 — CID 54844536
N-benzyl-3-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54844536) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-benzyl-3-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-benzyl-3-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54844536 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | N-benzyl-3-[[2-[4-(butylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCCCNC(=O)c1ccc(NC(=O)CNc2cccc(C(=O)NCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-2-3-16-28-26(33)21-12-14-23(15-13-21)31-25(32)19-29-24-11-7-10-22(17-24)27(34)30-18-20-8-5-4-6-9-20/h4-15,17,29H,2-3,16,18-19H2,1H3,(H,28,33)(H,30,34)(H,31,32) |
| InChIKey | HZNGCODAVIKRAJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|